C16H12Cl2N4O2S2 — CID 135430101
N-(3,4-dichlorophenyl)-2-[4-oxo-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135430101) has the molecular formula C16H12Cl2N4O2S2 and a molecular weight of 427.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-oxo-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-oxo-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135430101 |
| Molecular Formula | C16H12Cl2N4O2S2 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-oxo-2-(thiophen-2-ylmethylidenehydrazinylidene)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1SC(=NN=Cc2cccs2)NC1=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N4O2S2/c17-11-4-3-9(6-12(11)18)20-14(23)7-13-15(24)21-16(26-13)22-19-8-10-2-1-5-25-10/h1-6,8,13H,7H2,(H,20,23)(H,21,22,24) |
| InChIKey | DCHVGLNMLANBGA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|