C21H23N5O4S3 — CID 136719061
2-[(2Z,5S)-4-oxo-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 136719061) has the molecular formula C21H23N5O4S3 and a molecular weight of 505.65 g/mol. Its IUPAC name is 2-[(2Z,5S)-4-oxo-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(2Z,5S)-4-oxo-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 136719061 |
| Molecular Formula | C21H23N5O4S3 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2-[(2Z,5S)-4-oxo-2-[(Z)-thiophen-2-ylmethylidenehydrazinylidene]-1,3-thiazolidin-5-yl]-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(C[C@@H]1S/C(=N\N=C/c2cccs2)NC1=O)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H23N5O4S3/c27-19(13-18-20(28)24-21(32-18)25-22-14-16-5-4-12-31-16)23-15-6-8-17(9-7-15)33(29,30)26-10-2-1-3-11-26/h4-9,12,14,18H,1-3,10-11,13H2,(H,23,27)(H,24,25,28)/b22-14-/t18-/m0/s1 |
| InChIKey | PGAIVIMDLNVZCN-GFHXCNCHSA-N |
| XLogP | 2.87 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|