C17H14N4O5S — CID 135852296
4-[[2-[(2E,5S)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid (PubChem CID 135852296) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is 4-[[2-[(2E,5S)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[(2E,5S)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 135852296 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-[[2-[(2E,5S)-2-[(Z)-furan-2-ylmethylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
| SMILES | O=C(C[C@@H]1S/C(=N/N=C\c2ccco2)NC1=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H14N4O5S/c22-14(19-11-5-3-10(4-6-11)16(24)25)8-13-15(23)20-17(27-13)21-18-9-12-2-1-7-26-12/h1-7,9,13H,8H2,(H,19,22)(H,24,25)(H,20,21,23)/b18-9-/t13-/m0/s1 |
| InChIKey | QTGGSIRDFUUINK-OCTXWABXSA-N |
| XLogP | 1.93 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|