C13H14N4O5S — CID 135816842
(2S)-2-[[2-[(2E,5R)-2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]propanoic acid (PubChem CID 135816842) has the molecular formula C13H14N4O5S and a molecular weight of 338.35 g/mol. Its IUPAC name is (2S)-2-[[2-[(2E,5R)-2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-[(2E,5R)-2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 135816842 |
| Molecular Formula | C13H14N4O5S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (2S)-2-[[2-[(2E,5R)-2-(furan-2-ylmethylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)C[C@H]1S/C(=N/N=Cc2ccco2)NC1=O)C(=O)O |
| InChI | InChI=1S/C13H14N4O5S/c1-7(12(20)21)15-10(18)5-9-11(19)16-13(23-9)17-14-6-8-3-2-4-22-8/h2-4,6-7,9H,5H2,1H3,(H,15,18)(H,20,21)(H,16,17,19)/t7-,9+/m0/s1 |
| InChIKey | QCJKXMUQFJCAJK-IONNQARKSA-N |
| XLogP | 0.18 |
| TPSA | 133.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|