C24H23N3O2S — CID 135942077
(2E)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135942077) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is (2E)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135942077 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (2E)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-[(E)-[(E)-3-phenylprop-2-enylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1S/C(=N/N=C/C=C/c2ccccc2)NC1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H23N3O2S/c28-21(20-13-12-18-10-4-5-11-19(18)15-20)16-22-23(29)26-24(30-22)27-25-14-6-9-17-7-2-1-3-8-17/h1-3,6-9,12-15,22H,4-5,10-11,16H2,(H,26,27,29)/b9-6+,25-14+ |
| InChIKey | UMUATOUXXLBDFU-HQUXDSKKSA-N |
| XLogP | 4.43 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|