C24H17N3O2S — CID 135483358
2-(fluoren-9-ylidenehydrazinylidene)-5-phenacyl-1,3-thiazolidin-4-one (PubChem CID 135483358) has the molecular formula C24H17N3O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 2-(fluoren-9-ylidenehydrazinylidene)-5-phenacyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(fluoren-9-ylidenehydrazinylidene)-5-phenacyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135483358 |
| Molecular Formula | C24H17N3O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-(fluoren-9-ylidenehydrazinylidene)-5-phenacyl-1,3-thiazolidin-4-one |
| SMILES | O=C(CC1SC(=NN=C2c3ccccc3-c3ccccc32)NC1=O)c1ccccc1 |
| InChI | InChI=1S/C24H17N3O2S/c28-20(15-8-2-1-3-9-15)14-21-23(29)25-24(30-21)27-26-22-18-12-6-4-10-16(18)17-11-5-7-13-19(17)22/h1-13,21H,14H2,(H,25,27,29) |
| InChIKey | STNWWFDJELGPNZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|