About 2-imino-5-phenacyl-1,3-thiazolidin-4-one
2-imino-5-phenacyl-1,3-thiazolidin-4-one (PubChem CID 138978177) has the molecular formula C11H10N2O2S
and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-imino-5-phenacyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-imino-5-phenacyl-1,3-thiazolidin-4-one |
| PubChem CID | 138978177 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-imino-5-phenacyl-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)C(CC(=O)c2ccccc2)S1 |
| InChI | InChI=1S/C11H10N2O2S/c12-11-13-10(15)9(16-11)6-8(14)7-4-2-1-3-5-7/h1-5,9H,6H2,(H2,12,13,15) |
| InChIKey | MXAHRPXSWUWGBC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-5-phenacyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-5-phenacyl-1,3-thiazolidin-4-one?
The IUPAC name of 2-imino-5-phenacyl-1,3-thiazolidin-4-one (CID 138978177) is 2-imino-5-phenacyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-imino-5-phenacyl-1,3-thiazolidin-4-one?
The canonical SMILES for 2-imino-5-phenacyl-1,3-thiazolidin-4-one is [H]/N=C1/NC(=O)C(CC(=O)c2ccccc2)S1.
What is the InChIKey of 2-imino-5-phenacyl-1,3-thiazolidin-4-one?
The InChIKey is MXAHRPXSWUWGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c12-11-13-10(15)9(16-11)6-8(14)7-4-2-1-3-5-7/h1-5,9H,6H2,(H2,12,13,15).
What are the key properties of 2-imino-5-phenacyl-1,3-thiazolidin-4-one?
2-imino-5-phenacyl-1,3-thiazolidin-4-one has a molecular weight of 234.28 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-5-phenacyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 138978177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).