C18H17FN4O2S2 — CID 8942217
1-[(4-fluorophenyl)methyl]-3-[[2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea (PubChem CID 8942217) has the molecular formula C18H17FN4O2S2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 8942217 |
| Molecular Formula | C18H17FN4O2S2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea |
| SMILES | O=C(C[C@@H]1Sc2ccccc2NC1=O)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN4O2S2/c19-12-7-5-11(6-8-12)10-20-18(26)23-22-16(24)9-15-17(25)21-13-3-1-2-4-14(13)27-15/h1-8,15H,9-10H2,(H,21,25)(H,22,24)(H2,20,23,26)/t15-/m0/s1 |
| InChIKey | CLSMDDJJFMKEAB-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|