C19H26N4O2S2 — CID 11946392
1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea (PubChem CID 11946392) has the molecular formula C19H26N4O2S2 and a molecular weight of 406.58 g/mol. Its IUPAC name is 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea.
| Compound Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 11946392 |
| Molecular Formula | C19H26N4O2S2 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[[2-[(2R)-3-oxo-4H-1,4-benzothiazin-2-yl]acetyl]amino]thiourea |
| SMILES | C[C@H]1[C@@H](NC(=S)NNC(=O)C[C@H]2Sc3ccccc3NC2=O)CCC[C@@H]1C |
| InChI | InChI=1S/C19H26N4O2S2/c1-11-6-5-8-13(12(11)2)21-19(26)23-22-17(24)10-16-18(25)20-14-7-3-4-9-15(14)27-16/h3-4,7,9,11-13,16H,5-6,8,10H2,1-2H3,(H,20,25)(H,22,24)(H2,21,23,26)/t11-,12+,13-,16+/m0/s1 |
| InChIKey | AVTNITQCXWGWEO-RSUWNVLCSA-N |
| XLogP | 2.81 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|