C19H20N2O2S2 — CID 40791284
N-[2-(4-methylphenyl)sulfanylethyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide (PubChem CID 40791284) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-[2-(4-methylphenyl)sulfanylethyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide.
| Compound Name | N-[2-(4-methylphenyl)sulfanylethyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 40791284 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[2-(4-methylphenyl)sulfanylethyl]-2-[(2S)-3-oxo-4H-1,4-benzothiazin-2-yl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)C[C@@H]2Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C19H20N2O2S2/c1-13-6-8-14(9-7-13)24-11-10-20-18(22)12-17-19(23)21-15-4-2-3-5-16(15)25-17/h2-9,17H,10-12H2,1H3,(H,20,22)(H,21,23)/t17-/m0/s1 |
| InChIKey | WCXFRLRODHBFLN-KRWDZBQOSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|