C19H20N2O2S2 — CID 51161456
2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 51161456) has the molecular formula C19H20N2O2S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 51161456 |
| Molecular Formula | C19H20N2O2S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)NCCCSc1ccccc1 |
| InChI | InChI=1S/C19H20N2O2S2/c22-18(20-11-6-12-24-14-7-2-1-3-8-14)13-17-19(23)21-15-9-4-5-10-16(15)25-17/h1-5,7-10,17H,6,11-13H2,(H,20,22)(H,21,23) |
| InChIKey | AKKSVDONYUVDIU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|