C12H17NOS — CID 143681564
2-methyl-4H-1,4-benzothiazin-3-one;propane (PubChem CID 143681564) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-methyl-4H-1,4-benzothiazin-3-one;propane.
| Compound Name | 2-methyl-4H-1,4-benzothiazin-3-one;propane |
|---|---|
| PubChem CID | 143681564 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-methyl-4H-1,4-benzothiazin-3-one;propane |
| SMILES | CC1Sc2ccccc2NC1=O.CCC |
| InChI | InChI=1S/C9H9NOS.C3H8/c1-6-9(11)10-7-4-2-3-5-8(7)12-6;1-3-2/h2-6H,1H3,(H,10,11);3H2,1-2H3 |
| InChIKey | JVOMXWPHPTYJEH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |