C9H9NS2 — CID 84614586
2-methyl-4H-1,4-benzothiazine-3-thione (PubChem CID 84614586) has the molecular formula C9H9NS2 and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-methyl-4H-1,4-benzothiazine-3-thione.
| Compound Name | 2-methyl-4H-1,4-benzothiazine-3-thione |
|---|---|
| PubChem CID | 84614586 |
| Molecular Formula | C9H9NS2 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | 2-methyl-4H-1,4-benzothiazine-3-thione |
| SMILES | CC1Sc2ccccc2NC1=S |
| InChI | InChI=1S/C9H9NS2/c1-6-9(11)10-7-4-2-3-5-8(7)12-6/h2-6H,1H3,(H,10,11) |
| InChIKey | ZMUGAXHKDUCJHF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|