C9H10N2S — CID 21478536
3-methyl-3,4-dihydro-1H-quinoxaline-2-thione (PubChem CID 21478536) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-1H-quinoxaline-2-thione.
| Compound Name | 3-methyl-3,4-dihydro-1H-quinoxaline-2-thione |
|---|---|
| PubChem CID | 21478536 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-methyl-3,4-dihydro-1H-quinoxaline-2-thione |
| SMILES | CC1Nc2ccccc2NC1=S |
| InChI | InChI=1S/C9H10N2S/c1-6-9(12)11-8-5-3-2-4-7(8)10-6/h2-6,10H,1H3,(H,11,12) |
| InChIKey | ZPCPNLFCPYHDQX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|