C15H12N2S3 — CID 175478062
bis(2,3-dihydro-1,3-benzothiazol-2-yl)methanethione (PubChem CID 175478062) has the molecular formula C15H12N2S3 and a molecular weight of 316.48 g/mol. Its IUPAC name is bis(2,3-dihydro-1,3-benzothiazol-2-yl)methanethione.
| Compound Name | bis(2,3-dihydro-1,3-benzothiazol-2-yl)methanethione |
|---|---|
| PubChem CID | 175478062 |
| Molecular Formula | C15H12N2S3 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | bis(2,3-dihydro-1,3-benzothiazol-2-yl)methanethione |
| SMILES | S=C(C1Nc2ccccc2S1)C1Nc2ccccc2S1 |
| InChI | InChI=1S/C15H12N2S3/c18-13(14-16-9-5-1-3-7-11(9)19-14)15-17-10-6-2-4-8-12(10)20-15/h1-8,14-17H |
| InChIKey | WMMWYLGCMLQGKD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|