C11H17NS — CID 142049429
ethane;2-ethyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 142049429) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is ethane;2-ethyl-2,3-dihydro-1,3-benzothiazole.
| Compound Name | ethane;2-ethyl-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 142049429 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | ethane;2-ethyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | CC.CCC1Nc2ccccc2S1 |
| InChI | InChI=1S/C9H11NS.C2H6/c1-2-9-10-7-5-3-4-6-8(7)11-9;1-2/h3-6,9-10H,2H2,1H3;1-2H3 |
| InChIKey | YMAWIDZBXLNHAJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |