C9H12N2S — CID 146243816
N,N-dimethyl-2,3-dihydro-1,3-benzothiazol-2-amine (PubChem CID 146243816) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dihydro-1,3-benzothiazol-2-amine.
| Compound Name | N,N-dimethyl-2,3-dihydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 146243816 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | N,N-dimethyl-2,3-dihydro-1,3-benzothiazol-2-amine |
| SMILES | CN(C)C1Nc2ccccc2S1 |
| InChI | InChI=1S/C9H12N2S/c1-11(2)9-10-7-5-3-4-6-8(7)12-9/h3-6,9-10H,1-2H3 |
| InChIKey | OFPQGKOGKGIVFX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |