C22H36N2S4 — CID 91078039
2-(2,3-dihydro-1,3-benzothiazol-2-yldisulfanyl)-2,3-dihydro-1,3-benzothiazole;ethane (PubChem CID 91078039) has the molecular formula C22H36N2S4 and a molecular weight of 456.81 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,3-benzothiazol-2-yldisulfanyl)-2,3-dihydro-1,3-benzothiazole;ethane.
| Compound Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yldisulfanyl)-2,3-dihydro-1,3-benzothiazole;ethane |
|---|---|
| PubChem CID | 91078039 |
| Molecular Formula | C22H36N2S4 |
| Molecular Weight | 456.81 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-(2,3-dihydro-1,3-benzothiazol-2-yldisulfanyl)-2,3-dihydro-1,3-benzothiazole;ethane |
| SMILES | CC.CC.CC.CC.c1ccc2c(c1)NC(SSC1Nc3ccccc3S1)S2 |
| InChI | InChI=1S/C14H12N2S4.4C2H6/c1-3-7-11-9(5-1)15-13(17-11)19-20-14-16-10-6-2-4-8-12(10)18-14;4*1-2/h1-8,13-16H;4*1-2H3 |
| InChIKey | MUNFLIGXJISQQG-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.81 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|