About (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole
(2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 92935373) has the molecular formula C13H11NS
and a molecular weight of 213.31 g/mol. Its IUPAC name is (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 92935373 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | c1ccc([C@@H]2Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C13H11NS/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9,13-14H/t13-/m1/s1 |
| InChIKey | YKJUYTXCRIKRND-CYBMUJFWSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole?
The IUPAC name of (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole (CID 92935373) is (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole is c1ccc([C@@H]2Nc3ccccc3S2)cc1.
What is the InChIKey of (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole?
The InChIKey is YKJUYTXCRIKRND-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H11NS/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9,13-14H/t13-/m1/s1.
What are the key properties of (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole?
(2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole has a molecular weight of 213.31 g/mol, XLogP of 3.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 92935373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).