C13H11NS — CID 92935373
(2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 92935373) has the molecular formula C13H11NS and a molecular weight of 213.31 g/mol. Its IUPAC name is (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole.
| Compound Name | (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 92935373 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (2R)-2-phenyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | c1ccc([C@@H]2Nc3ccccc3S2)cc1 |
| InChI | InChI=1S/C13H11NS/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-9,13-14H/t13-/m1/s1 |
| InChIKey | YKJUYTXCRIKRND-CYBMUJFWSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |