C14H27NS — CID 145235335
ethane;2-methyl-2,3-dihydro-1,3-benzothiazole (PubChem CID 145235335) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is ethane;2-methyl-2,3-dihydro-1,3-benzothiazole.
| Compound Name | ethane;2-methyl-2,3-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 145235335 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | ethane;2-methyl-2,3-dihydro-1,3-benzothiazole |
| SMILES | CC.CC.CC.CC1Nc2ccccc2S1 |
| InChI | InChI=1S/C8H9NS.3C2H6/c1-6-9-7-4-2-3-5-8(7)10-6;3*1-2/h2-6,9H,1H3;3*1-2H3 |
| InChIKey | SFMNNANLOXFQES-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |