C8H9NO3S2 — CID 129147850
2-methyl-2,3-dihydro-1,3-benzothiazole-6-sulfonic acid (PubChem CID 129147850) has the molecular formula C8H9NO3S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1,3-benzothiazole-6-sulfonic acid.
| Compound Name | 2-methyl-2,3-dihydro-1,3-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 129147850 |
| Molecular Formula | C8H9NO3S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 2-methyl-2,3-dihydro-1,3-benzothiazole-6-sulfonic acid |
| SMILES | CC1Nc2ccc(S(=O)(=O)O)cc2S1 |
| InChI | InChI=1S/C8H9NO3S2/c1-5-9-7-3-2-6(14(10,11)12)4-8(7)13-5/h2-5,9H,1H3,(H,10,11,12) |
| InChIKey | UPCBCVFDDNAYCV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|