C11H10N2O6S3 — CID 143889828
2-amino-2,3-dihydrobenzo[g][1,3]benzothiazole-6,8-disulfonic acid (PubChem CID 143889828) has the molecular formula C11H10N2O6S3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-amino-2,3-dihydrobenzo[g][1,3]benzothiazole-6,8-disulfonic acid.
| Compound Name | 2-amino-2,3-dihydrobenzo[g][1,3]benzothiazole-6,8-disulfonic acid |
|---|---|
| PubChem CID | 143889828 |
| Molecular Formula | C11H10N2O6S3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 2-amino-2,3-dihydrobenzo[g][1,3]benzothiazole-6,8-disulfonic acid |
| SMILES | NC1Nc2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c2S1 |
| InChI | InChI=1S/C11H10N2O6S3/c12-11-13-8-2-1-6-7(10(8)20-11)3-5(21(14,15)16)4-9(6)22(17,18)19/h1-4,11,13H,12H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | HOTCFXZBECDCON-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|