C23H26N4O9S3 — CID 142009083
7-aminonaphthalene-1,3,5-trisulfonic acid;benzene-1,4-diamine;4-methylaniline (PubChem CID 142009083) has the molecular formula C23H26N4O9S3 and a molecular weight of 598.68 g/mol. Its IUPAC name is 7-aminonaphthalene-1,3,5-trisulfonic acid;benzene-1,4-diamine;4-methylaniline.
| Compound Name | 7-aminonaphthalene-1,3,5-trisulfonic acid;benzene-1,4-diamine;4-methylaniline |
|---|---|
| PubChem CID | 142009083 |
| Molecular Formula | C23H26N4O9S3 |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 7-aminonaphthalene-1,3,5-trisulfonic acid;benzene-1,4-diamine;4-methylaniline |
| SMILES | Cc1ccc(N)cc1.Nc1cc(S(=O)(=O)O)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2c1.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C10H9NO9S3.C7H9N.C6H8N2/c11-5-1-7-8(9(2-5)22(15,16)17)3-6(21(12,13)14)4-10(7)23(18,19)20;1-6-2-4-7(8)5-3-6;7-5-1-2-6(8)4-3-5/h1-4H,11H2,(H,12,13,14)(H,15,16,17)(H,18,19,20);2-5H,8H2,1H3;1-4H,7-8H2 |
| InChIKey | VGXMLNDHCIPWCM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 267.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|