C12H14N2O6S2 — CID 89359053
5,6-bis(methylamino)naphthalene-1,3-disulfonic acid (PubChem CID 89359053) has the molecular formula C12H14N2O6S2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 5,6-bis(methylamino)naphthalene-1,3-disulfonic acid.
| Compound Name | 5,6-bis(methylamino)naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 89359053 |
| Molecular Formula | C12H14N2O6S2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 5,6-bis(methylamino)naphthalene-1,3-disulfonic acid |
| SMILES | CNc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1NC |
| InChI | InChI=1S/C12H14N2O6S2/c1-13-10-4-3-8-9(12(10)14-2)5-7(21(15,16)17)6-11(8)22(18,19)20/h3-6,13-14H,1-2H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | JGCZSCKQXDAMES-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|