C8H11NO6S2 — CID 123727868
5-methyl-4-(methylamino)benzene-1,3-disulfonic acid (PubChem CID 123727868) has the molecular formula C8H11NO6S2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-methyl-4-(methylamino)benzene-1,3-disulfonic acid.
| Compound Name | 5-methyl-4-(methylamino)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 123727868 |
| Molecular Formula | C8H11NO6S2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.00 |
| IUPAC Name | 5-methyl-4-(methylamino)benzene-1,3-disulfonic acid |
| SMILES | CNc1c(C)cc(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C8H11NO6S2/c1-5-3-6(16(10,11)12)4-7(8(5)9-2)17(13,14)15/h3-4,9H,1-2H3,(H,10,11,12)(H,13,14,15) |
| InChIKey | JVZAZMNWILFFRH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|