C12H13NO6S2 — CID 18343814
6-methyl-7-(methylamino)naphthalene-1,3-disulfonic acid (PubChem CID 18343814) has the molecular formula C12H13NO6S2 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6-methyl-7-(methylamino)naphthalene-1,3-disulfonic acid.
| Compound Name | 6-methyl-7-(methylamino)naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 18343814 |
| Molecular Formula | C12H13NO6S2 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6-methyl-7-(methylamino)naphthalene-1,3-disulfonic acid |
| SMILES | CNc1cc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2cc1C |
| InChI | InChI=1S/C12H13NO6S2/c1-7-3-8-4-9(20(14,15)16)5-12(21(17,18)19)10(8)6-11(7)13-2/h3-6,13H,1-2H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | IGLDAZWOHQMZBA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|