C11H11NO9S3 — CID 154105697
6-(methylamino)naphthalene-1,3,5-trisulfonic acid (PubChem CID 154105697) has the molecular formula C11H11NO9S3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 6-(methylamino)naphthalene-1,3,5-trisulfonic acid.
| Compound Name | 6-(methylamino)naphthalene-1,3,5-trisulfonic acid |
|---|---|
| PubChem CID | 154105697 |
| Molecular Formula | C11H11NO9S3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | 6-(methylamino)naphthalene-1,3,5-trisulfonic acid |
| SMILES | CNc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)cc2c1S(=O)(=O)O |
| InChI | InChI=1S/C11H11NO9S3/c1-12-9-3-2-7-8(11(9)24(19,20)21)4-6(22(13,14)15)5-10(7)23(16,17)18/h2-5,12H,1H3,(H,13,14,15)(H,16,17,18)(H,19,20,21) |
| InChIKey | JGJRBLGQZWBNNK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 175.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|