C15H17NO6S2 — CID 144708930
1,1,2-trimethyl-2,3-dihydrobenzo[e]indole-6,8-disulfonic acid (PubChem CID 144708930) has the molecular formula C15H17NO6S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1,1,2-trimethyl-2,3-dihydrobenzo[e]indole-6,8-disulfonic acid.
| Compound Name | 1,1,2-trimethyl-2,3-dihydrobenzo[e]indole-6,8-disulfonic acid |
|---|---|
| PubChem CID | 144708930 |
| Molecular Formula | C15H17NO6S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 1,1,2-trimethyl-2,3-dihydrobenzo[e]indole-6,8-disulfonic acid |
| SMILES | CC1Nc2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c2C1(C)C |
| InChI | InChI=1S/C15H17NO6S2/c1-8-15(2,3)14-11-6-9(23(17,18)19)7-13(24(20,21)22)10(11)4-5-12(14)16-8/h4-8,16H,1-3H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | DRULJUSPDJNVHQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|