C21H25NO8S2 — CID 89441828
1-(6-methoxy-6-oxohexyl)-1,2-dimethylbenzo[e]indole-6,8-disulfonic acid (PubChem CID 89441828) has the molecular formula C21H25NO8S2 and a molecular weight of 483.56 g/mol. Its IUPAC name is 1-(6-methoxy-6-oxohexyl)-1,2-dimethylbenzo[e]indole-6,8-disulfonic acid.
| Compound Name | 1-(6-methoxy-6-oxohexyl)-1,2-dimethylbenzo[e]indole-6,8-disulfonic acid |
|---|---|
| PubChem CID | 89441828 |
| Molecular Formula | C21H25NO8S2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 1-(6-methoxy-6-oxohexyl)-1,2-dimethylbenzo[e]indole-6,8-disulfonic acid |
| SMILES | COC(=O)CCCCCC1(C)C(C)=Nc2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c21 |
| InChI | InChI=1S/C21H25NO8S2/c1-13-21(2,10-6-4-5-7-19(23)30-3)20-16-11-14(31(24,25)26)12-18(32(27,28)29)15(16)8-9-17(20)22-13/h8-9,11-12H,4-7,10H2,1-3H3,(H,24,25,26)(H,27,28,29) |
| InChIKey | KSBMGRRLQJVVSP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|