C18H22NO12S4+ — CID 175630078
1,2-dimethyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-6,8-disulfonic acid (PubChem CID 175630078) has the molecular formula C18H22NO12S4+ and a molecular weight of 572.64 g/mol. Its IUPAC name is 1,2-dimethyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-6,8-disulfonic acid.
| Compound Name | 1,2-dimethyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-6,8-disulfonic acid |
|---|---|
| PubChem CID | 175630078 |
| Molecular Formula | C18H22NO12S4+ |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.00 |
| IUPAC Name | 1,2-dimethyl-1-(sulfomethyl)-3-(3-sulfopropyl)benzo[e]indol-3-ium-6,8-disulfonic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c2C1(C)CS(=O)(=O)O |
| InChI | InChI=1S/C18H21NO12S4/c1-11-18(2,10-33(23,24)25)17-14-8-12(34(26,27)28)9-16(35(29,30)31)13(14)4-5-15(17)19(11)6-3-7-32(20,21)22/h4-5,8-9H,3,6-7,10H2,1-2H3,(H3-,20,21,22,23,24,25,26,27,28,29,30,31)/p+1 |
| InChIKey | LZJKPMNARDQKKP-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 220.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|