C34H40N2O12S4+2 — CID 160815584
3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid;3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-6,8-disulfonic acid (PubChem CID 160815584) has the molecular formula C34H40N2O12S4+2 and a molecular weight of 796.96 g/mol. Its IUPAC name is 3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid;3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-6,8-disulfonic acid.
| Compound Name | 3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid;3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-6,8-disulfonic acid |
|---|---|
| PubChem CID | 160815584 |
| Molecular Formula | C34H40N2O12S4+2 |
| Molecular Weight | 796.96 g/mol |
| Exact Mass | 796.15 |
| IUPAC Name | 3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid;3-ethyl-1,1,2-trimethylbenzo[e]indol-3-ium-6,8-disulfonic acid |
| SMILES | CC[N+]1=C(C)C(C)(C)c2c1cc(S(=O)(=O)O)c1cc(S(=O)(=O)O)ccc21.CC[N+]1=C(C)C(C)(C)c2c1ccc1c(S(=O)(=O)O)cc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/2C17H19NO6S2/c1-5-18-10(2)17(3,4)16-13-8-11(25(19,20)21)9-15(26(22,23)24)12(13)6-7-14(16)18;1-5-18-10(2)17(3,4)16-12-7-6-11(25(19,20)21)8-13(12)15(9-14(16)18)26(22,23)24/h2*6-9H,5H2,1-4H3,(H-,19,20,21,22,23,24)/p+2 |
| InChIKey | SEVYQJCWXUKVMD-UHFFFAOYSA-P |
| XLogP | 5.50 |
| TPSA | 223.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.96 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|