C22H22NO9S3+ — CID 123136248
3-(3-methoxysulfonylphenyl)-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid (PubChem CID 123136248) has the molecular formula C22H22NO9S3+ and a molecular weight of 540.62 g/mol. Its IUPAC name is 3-(3-methoxysulfonylphenyl)-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid.
| Compound Name | 3-(3-methoxysulfonylphenyl)-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid |
|---|---|
| PubChem CID | 123136248 |
| Molecular Formula | C22H22NO9S3+ |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.05 |
| IUPAC Name | 3-(3-methoxysulfonylphenyl)-1,1,2-trimethylbenzo[e]indol-3-ium-5,7-disulfonic acid |
| SMILES | COS(=O)(=O)c1cccc([N+]2=C(C)C(C)(C)c3c2cc(S(=O)(=O)O)c2cc(S(=O)(=O)O)ccc32)c1 |
| InChI | InChI=1S/C22H21NO9S3/c1-13-22(2,3)21-17-9-8-15(33(24,25)26)11-18(17)20(34(27,28)29)12-19(21)23(13)14-6-5-7-16(10-14)35(30,31)32-4/h5-12H,1-4H3,(H-,24,25,26,27,28,29)/p+1 |
| InChIKey | ITUGRHYGAGJHHN-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|