C21H26NO5S+ — CID 123963457
6-(1,1,2-trimethyl-8-sulfobenzo[e]indol-3-ium-3-yl)hexanoic acid (PubChem CID 123963457) has the molecular formula C21H26NO5S+ and a molecular weight of 404.51 g/mol. Its IUPAC name is 6-(1,1,2-trimethyl-8-sulfobenzo[e]indol-3-ium-3-yl)hexanoic acid.
| Compound Name | 6-(1,1,2-trimethyl-8-sulfobenzo[e]indol-3-ium-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 123963457 |
| Molecular Formula | C21H26NO5S+ |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-(1,1,2-trimethyl-8-sulfobenzo[e]indol-3-ium-3-yl)hexanoic acid |
| SMILES | CC1=[N+](CCCCCC(=O)O)c2ccc3ccc(S(=O)(=O)O)cc3c2C1(C)C |
| InChI | InChI=1S/C21H25NO5S/c1-14-21(2,3)20-17-13-16(28(25,26)27)10-8-15(17)9-11-18(20)22(14)12-6-4-5-7-19(23)24/h8-11,13H,4-7,12H2,1-3H3,(H-,23,24,25,26,27)/p+1 |
| InChIKey | JPZDJMULKXWMHT-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|