C19H28NO2+ — CID 58152995
6-(5-ethyl-2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid (PubChem CID 58152995) has the molecular formula C19H28NO2+ and a molecular weight of 302.44 g/mol. Its IUPAC name is 6-(5-ethyl-2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid.
| Compound Name | 6-(5-ethyl-2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 58152995 |
| Molecular Formula | C19H28NO2+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 6-(5-ethyl-2,3,3-trimethylindol-1-ium-1-yl)hexanoic acid |
| SMILES | CCc1ccc2c(c1)C(C)(C)C(C)=[N+]2CCCCCC(=O)O |
| InChI | InChI=1S/C19H27NO2/c1-5-15-10-11-17-16(13-15)19(3,4)14(2)20(17)12-8-6-7-9-18(21)22/h10-11,13H,5-9,12H2,1-4H3/p+1 |
| InChIKey | MEFNPPZUEVJFRO-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|