C16H22NO2+ — CID 58526611
1-butyl-2,3,3-trimethylindol-1-ium-5-carboxylic acid (PubChem CID 58526611) has the molecular formula C16H22NO2+ and a molecular weight of 260.36 g/mol. Its IUPAC name is 1-butyl-2,3,3-trimethylindol-1-ium-5-carboxylic acid.
| Compound Name | 1-butyl-2,3,3-trimethylindol-1-ium-5-carboxylic acid |
|---|---|
| PubChem CID | 58526611 |
| Molecular Formula | C16H22NO2+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-butyl-2,3,3-trimethylindol-1-ium-5-carboxylic acid |
| SMILES | CCCC[N+]1=C(C)C(C)(C)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C16H21NO2/c1-5-6-9-17-11(2)16(3,4)13-10-12(15(18)19)7-8-14(13)17/h7-8,10H,5-6,9H2,1-4H3/p+1 |
| InChIKey | NUFDSZIAIMNCKQ-UHFFFAOYSA-O |
| XLogP | 3.58 |
| TPSA | 40.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|