C15H22BrN — CID 71698932
1-butyl-2,3,3-trimethylindol-1-ium bromide (PubChem CID 71698932) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 1-butyl-2,3,3-trimethylindol-1-ium bromide.
| Compound Name | 1-butyl-2,3,3-trimethylindol-1-ium bromide |
|---|---|
| PubChem CID | 71698932 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-butyl-2,3,3-trimethylindol-1-ium bromide |
| SMILES | CCCC[N+]1=C(C)C(C)(C)c2ccccc21.[Br-] |
| InChI | InChI=1S/C15H22N.BrH/c1-5-6-11-16-12(2)15(3,4)13-9-7-8-10-14(13)16;/h7-10H,5-6,11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HAOZJFDIXWUNMM-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|