C19H28NO2+ — CID 59310591
ethyl 6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoate (PubChem CID 59310591) has the molecular formula C19H28NO2+ and a molecular weight of 302.44 g/mol. Its IUPAC name is ethyl 6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoate.
| Compound Name | ethyl 6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoate |
|---|---|
| PubChem CID | 59310591 |
| Molecular Formula | C19H28NO2+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | ethyl 6-(2,3,3-trimethylindol-1-ium-1-yl)hexanoate |
| SMILES | CCOC(=O)CCCCC[N+]1=C(C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H28NO2/c1-5-22-18(21)13-7-6-10-14-20-15(2)19(3,4)16-11-8-9-12-17(16)20/h8-9,11-12H,5-7,10,13-14H2,1-4H3/q+1 |
| InChIKey | OAROIJHJCIDPRC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|