C21H25N2O+ — CID 11188805
N-phenyl-4-(2,3,3-trimethylindol-1-ium-1-yl)butanamide (PubChem CID 11188805) has the molecular formula C21H25N2O+ and a molecular weight of 321.44 g/mol. Its IUPAC name is N-phenyl-4-(2,3,3-trimethylindol-1-ium-1-yl)butanamide.
| Compound Name | N-phenyl-4-(2,3,3-trimethylindol-1-ium-1-yl)butanamide |
|---|---|
| PubChem CID | 11188805 |
| Molecular Formula | C21H25N2O+ |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | N-phenyl-4-(2,3,3-trimethylindol-1-ium-1-yl)butanamide |
| SMILES | CC1=[N+](CCCC(=O)Nc2ccccc2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H24N2O/c1-16-21(2,3)18-12-7-8-13-19(18)23(16)15-9-14-20(24)22-17-10-5-4-6-11-17/h4-8,10-13H,9,14-15H2,1-3H3/p+1 |
| InChIKey | XWNFHERHQMZICC-UHFFFAOYSA-O |
| XLogP | 4.50 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|