C17H24NO5S+ — CID 87293145
4-[2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-3-yl]butanoic acid (PubChem CID 87293145) has the molecular formula C17H24NO5S+ and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-3-yl]butanoic acid.
| Compound Name | 4-[2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-3-yl]butanoic acid |
|---|---|
| PubChem CID | 87293145 |
| Molecular Formula | C17H24NO5S+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-[2,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-3-yl]butanoic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccccc2C1(C)CCCC(=O)O |
| InChI | InChI=1S/C17H23NO5S/c1-13-17(2,10-5-9-16(19)20)14-7-3-4-8-15(14)18(13)11-6-12-24(21,22)23/h3-4,7-8H,5-6,9-12H2,1-2H3,(H-,19,20,21,22,23)/p+1 |
| InChIKey | MFRWEQKGXDFBBH-UHFFFAOYSA-O |
| XLogP | 2.60 |
| TPSA | 94.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|