C16H23NO7S2 — CID 172863311
1-(2-methoxyethyl)-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate (PubChem CID 172863311) has the molecular formula C16H23NO7S2 and a molecular weight of 405.49 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate.
| Compound Name | 1-(2-methoxyethyl)-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 172863311 |
| Molecular Formula | C16H23NO7S2 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(2-methoxyethyl)-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonate |
| SMILES | COCC[N+]1=C(C)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)[O-])ccc21 |
| InChI | InChI=1S/C16H23NO7S2/c1-12-16(2,7-4-10-25(18,19)20)14-11-13(26(21,22)23)5-6-15(14)17(12)8-9-24-3/h5-6,11H,4,7-10H2,1-3H3,(H-,18,19,20,21,22,23) |
| InChIKey | ZQMURQCKESIGJV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|