C19H30NO6S2+ — CID 90321855
1-hexyl-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 90321855) has the molecular formula C19H30NO6S2+ and a molecular weight of 432.58 g/mol. Its IUPAC name is 1-hexyl-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 1-hexyl-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 90321855 |
| Molecular Formula | C19H30NO6S2+ |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-hexyl-2,3-dimethyl-3-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CCCCCC[N+]1=C(C)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C19H29NO6S2/c1-4-5-6-7-12-20-15(2)19(3,11-8-13-27(21,22)23)17-14-16(28(24,25)26)9-10-18(17)20/h9-10,14H,4-8,11-13H2,1-3H3,(H-,21,22,23,24,25,26)/p+1 |
| InChIKey | DRMHUHOQJAFNMW-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|