C15H21NNaO6S2 — CID 87293189
CID 87293189 (PubChem CID 87293189) has the molecular formula C15H21NNaO6S2 and a molecular weight of 398.46 g/mol.
| Compound Name | CID 87293189 |
|---|---|
| PubChem CID | 87293189 |
| Molecular Formula | C15H21NNaO6S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | — |
| SMILES | CC[N+]1=C(C)C(C)(CCCS(=O)(=O)O)c2cc(S(=O)(=O)[O-])ccc21.[Na] |
| InChI | InChI=1S/C15H21NO6S2.Na/c1-4-16-11(2)15(3,8-5-9-23(17,18)19)13-10-12(24(20,21)22)6-7-14(13)16;/h6-7,10H,4-5,8-9H2,1-3H3,(H-,17,18,19,20,21,22); |
| InChIKey | YAZJUUYXQBKEOJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 114.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|