C17H26NO3S+ — CID 89409626
3-(3-butyl-2,3-dimethylindol-1-ium-1-yl)propane-1-sulfonic acid (PubChem CID 89409626) has the molecular formula C17H26NO3S+ and a molecular weight of 324.47 g/mol. Its IUPAC name is 3-(3-butyl-2,3-dimethylindol-1-ium-1-yl)propane-1-sulfonic acid.
| Compound Name | 3-(3-butyl-2,3-dimethylindol-1-ium-1-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 89409626 |
| Molecular Formula | C17H26NO3S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-(3-butyl-2,3-dimethylindol-1-ium-1-yl)propane-1-sulfonic acid |
| SMILES | CCCCC1(C)C(C)=[N+](CCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C17H25NO3S/c1-4-5-11-17(3)14(2)18(12-8-13-22(19,20)21)16-10-7-6-9-15(16)17/h6-7,9-10H,4-5,8,11-13H2,1-3H3/p+1 |
| InChIKey | UOCVPHBKDOTKDS-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|