C16H24NO3S+ — CID 147781171
3-(3,3-diethyl-2-methylindol-1-ium-1-yl)propane-1-sulfonic acid (PubChem CID 147781171) has the molecular formula C16H24NO3S+ and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(3,3-diethyl-2-methylindol-1-ium-1-yl)propane-1-sulfonic acid.
| Compound Name | 3-(3,3-diethyl-2-methylindol-1-ium-1-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 147781171 |
| Molecular Formula | C16H24NO3S+ |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-(3,3-diethyl-2-methylindol-1-ium-1-yl)propane-1-sulfonic acid |
| SMILES | CCC1(CC)C(C)=[N+](CCCS(=O)(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H23NO3S/c1-4-16(5-2)13(3)17(11-8-12-21(18,19)20)15-10-7-6-9-14(15)16/h6-7,9-10H,4-5,8,11-12H2,1-3H3/p+1 |
| InChIKey | RBKZLPBPDJUEFK-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|