C14H20NNaO6S2+2 — CID 87803043
sodium 2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 87803043) has the molecular formula C14H20NNaO6S2+2 and a molecular weight of 385.44 g/mol. Its IUPAC name is sodium 2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | sodium 2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 87803043 |
| Molecular Formula | C14H20NNaO6S2+2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | sodium 2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC1=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc2C1(C)C.[Na+] |
| InChI | InChI=1S/C14H19NO6S2.Na/c1-10-14(2,3)12-9-11(23(19,20)21)5-6-13(12)15(10)7-4-8-22(16,17)18;/h5-6,9H,4,7-8H2,1-3H3,(H-,16,17,18,19,20,21);/q;+1/p+1 |
| InChIKey | RANLTMVHUAJMKY-UHFFFAOYSA-O |
| XLogP | -1.39 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|