C23H27N2O6S2+ — CID 152754531
2-(4-anilinobuta-1,3-dienyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid (PubChem CID 152754531) has the molecular formula C23H27N2O6S2+ and a molecular weight of 491.61 g/mol. Its IUPAC name is 2-(4-anilinobuta-1,3-dienyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-(4-anilinobuta-1,3-dienyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 152754531 |
| Molecular Formula | C23H27N2O6S2+ |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-(4-anilinobuta-1,3-dienyl)-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonic acid |
| SMILES | CC1(C)C(C=CC=CNc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C23H26N2O6S2/c1-23(2)20-17-19(33(29,30)31)12-13-21(20)25(15-8-16-32(26,27)28)22(23)11-6-7-14-24-18-9-4-3-5-10-18/h3-7,9-14,17H,8,15-16H2,1-2H3,(H2,26,27,28,29,30,31)/p+1 |
| InChIKey | ZKGSZJOCRVFRNX-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 123.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|