C25H28N2NaO6S2+ — CID 23586408
sodium 3-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonic acid (PubChem CID 23586408) has the molecular formula C25H28N2NaO6S2+ and a molecular weight of 539.63 g/mol. Its IUPAC name is sodium 3-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | sodium 3-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 23586408 |
| Molecular Formula | C25H28N2NaO6S2+ |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | sodium 3-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-oxidoperoxysulfanylindol-1-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C/Nc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc(SOO[O-])cc21.[Na+] |
| InChI | InChI=1S/C25H28N2O6S2.Na/c1-25(2)22-19-21(34-33-32-28)14-15-23(22)27(17-10-18-35(29,30)31)24(25)13-8-3-4-9-16-26-20-11-6-5-7-12-20;/h3-9,11-16,19H,10,17-18H2,1-2H3,(H2,28,29,30,31);/q;+1 |
| InChIKey | QPGIMJBMRYOMAF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|