C27H29N2O9S3+ — CID 90718606
2-(4-anilinobuta-1,3-dienyl)-1,1-dimethyl-3-(3-sulfopropyl)-6-(trioxidanylsulfanyl)benzo[e]indol-3-ium-8-sulfonic acid (PubChem CID 90718606) has the molecular formula C27H29N2O9S3+ and a molecular weight of 621.74 g/mol. Its IUPAC name is 2-(4-anilinobuta-1,3-dienyl)-1,1-dimethyl-3-(3-sulfopropyl)-6-(trioxidanylsulfanyl)benzo[e]indol-3-ium-8-sulfonic acid.
| Compound Name | 2-(4-anilinobuta-1,3-dienyl)-1,1-dimethyl-3-(3-sulfopropyl)-6-(trioxidanylsulfanyl)benzo[e]indol-3-ium-8-sulfonic acid |
|---|---|
| PubChem CID | 90718606 |
| Molecular Formula | C27H29N2O9S3+ |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | 2-(4-anilinobuta-1,3-dienyl)-1,1-dimethyl-3-(3-sulfopropyl)-6-(trioxidanylsulfanyl)benzo[e]indol-3-ium-8-sulfonic acid |
| SMILES | CC1(C)C(C=CC=CNc2ccccc2)=[N+](CCCS(=O)(=O)O)c2ccc3c(SOOO)cc(S(=O)(=O)O)cc3c21 |
| InChI | InChI=1S/C27H28N2O9S3/c1-27(2)25(11-6-7-14-28-19-9-4-3-5-10-19)29(15-8-16-40(31,32)33)23-13-12-21-22(26(23)27)17-20(41(34,35)36)18-24(21)39-38-37-30/h3-7,9-14,17-18H,8,15-16H2,1-2H3,(H3,30,31,32,33,34,35,36)/p+1 |
| InChIKey | ABBMIAJXLUWNGV-UHFFFAOYSA-O |
| XLogP | 5.35 |
| TPSA | 162.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|