C26H31N2O5S+ — CID 58937777
6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid (PubChem CID 58937777) has the molecular formula C26H31N2O5S+ and a molecular weight of 483.61 g/mol. Its IUPAC name is 6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 58937777 |
| Molecular Formula | C26H31N2O5S+ |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 6-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-sulfoindol-1-ium-1-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/C=C/Nc2ccccc2)=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C26H30N2O5S/c1-26(2)22-19-21(34(31,32)33)15-16-23(22)28(18-10-4-7-14-25(29)30)24(26)13-8-9-17-27-20-11-5-3-6-12-20/h3,5-6,8-9,11-13,15-17,19H,4,7,10,14,18H2,1-2H3,(H2,29,30,31,32,33)/p+1 |
| InChIKey | LBQAHYCHFFWPCT-UHFFFAOYSA-O |
| XLogP | 5.14 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|