C26H32N2O8S2 — CID 172858499
3-[2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3-methyl-5-sulfoindol-1-ium-3-yl]propane-1-sulfonate (PubChem CID 172858499) has the molecular formula C26H32N2O8S2 and a molecular weight of 564.68 g/mol. Its IUPAC name is 3-[2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3-methyl-5-sulfoindol-1-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3-methyl-5-sulfoindol-1-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 172858499 |
| Molecular Formula | C26H32N2O8S2 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 3-[2-[(E)-2-anilinoethenyl]-1-(5-carboxypentyl)-3-methyl-5-sulfoindol-1-ium-3-yl]propane-1-sulfonate |
| SMILES | CC1(CCCS(=O)(=O)[O-])C(/C=C/Nc2ccccc2)=[N+](CCCCCC(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C26H32N2O8S2/c1-26(15-8-18-37(31,32)33)22-19-21(38(34,35)36)12-13-23(22)28(17-7-3-6-11-25(29)30)24(26)14-16-27-20-9-4-2-5-10-20/h2,4-5,9-10,12-14,16,19H,3,6-8,11,15,17-18H2,1H3,(H3,29,30,31,32,33,34,35,36) |
| InChIKey | ZAOGUOQZJPNFQK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 163.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|